CAS:1502-22-3 | 2-(1-Cyclohexenyl)cyclohexanone
Molecular Formula:C12H18O
Molecular Weight:178.28g/mol
Purity:85% cont. ca 10% 2-cyclohexylidene
Package:5g/10g/25g/50g/bulk package
Transportation:FeDex/DHL/Ocean shipping/Clients requirement
- বিশ্বব্যাপী ডেলিভারি
- গুণ নিশ্চিত করা
- 24/7 গ্রাহক পরিষেবা
পণ্য পরিচিতি
Applications
2-(1-Cyclohexenyl)cyclohexanone(CAS:1502-22-3) has a variety of applications in scientific research. It has been used in the synthesis of pharmaceuticals, such as anti-inflammatory drugs, and in the production of cosmetics. It has also been used in the synthesis of other compounds, such as esters and amines. Additionally, it has been used in the synthesis of polymers, such as polyurethane, and in the synthesis of artificial sweeteners.
Specification
|
ITEMS |
SPECIFICATION |
|
IUPAC Name |
2-(cyclohexen-1-yl)cyclohexan-1-one |
|
MDL No |
MFCD00013796 |
|
Boiling Point |
265°C |
|
Density |
0.998 g/ml |
|
PSA |
17.07 |
|
LogP |
3.25 |
|
Appearance |
Colorless to light yellow liquid |
|
Vapour Pressure |
0.00346mmHg at 25°C |
|
Refractive index |
1.5060 |
|
Storage condition |
Sealed in dry,Room Temperature |
|
InChI |
InChI=1S/C12H18O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h6,11H,1-5,7-9H2 |
|
InChIKey |
GVNVAWHJIKLAGL-UHFFFAOYSA-N |

গরম ট্যাগ: cas:1502-22-3 | 2-(1-cyclohexenyl)cyclohexanone, price, quotation, discount, in stock, for sale




![CAS: 28687-00-5 Spiro[4H-cyclopenta[2,1-b:3,4-b']dithiophene-4,9'-[9H]ফ্লুরিন]](/uploads/202235855/small/cas-28687-00-5-spiro-4h-cyclopenta-2-1-b-3-416389067960.png?size=384x0)
![CAS: 1174223-25-6 বেনজো[1,2-b:3,4-b':5,6-b'']ট্রিস্টিওফিন-2,5,{{ 9} ট্রাইকারবক্সিলিক অ্যাসিড](/uploads/202235855/small/cas-1174223-25-6-benzo-1-2-b-3-4-b-5-6-b00313938696.png?size=384x0)


